C25H43N5O — CID 111834301
1-[2-(diethylamino)-2-phenylethyl]-3-ethyl-2-[(4-pyrrolidin-1-yloxan-4-yl)methyl]guanidine (PubChem CID 111834301) has the molecular formula C25H43N5O and a molecular weight of 429.65 g/mol. Its IUPAC name is 1-[2-(diethylamino)-2-phenylethyl]-3-ethyl-2-[(4-pyrrolidin-1-yloxan-4-yl)methyl]guanidine.
| Compound Name | 1-[2-(diethylamino)-2-phenylethyl]-3-ethyl-2-[(4-pyrrolidin-1-yloxan-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111834301 |
| Molecular Formula | C25H43N5O |
| Molecular Weight | 429.65 g/mol |
| Exact Mass | 429.35 |
| IUPAC Name | 1-[2-(diethylamino)-2-phenylethyl]-3-ethyl-2-[(4-pyrrolidin-1-yloxan-4-yl)methyl]guanidine |
| SMILES | CCN/C(=N\CC1(N2CCCC2)CCOCC1)NCC(c1ccccc1)N(CC)CC |
| InChI | InChI=1S/C25H43N5O/c1-4-26-24(27-20-23(29(5-2)6-3)22-12-8-7-9-13-22)28-21-25(14-18-31-19-15-25)30-16-10-11-17-30/h7-9,12-13,23H,4-6,10-11,14-21H2,1-3H3,(H2,26,27,28) |
| InChIKey | YOTSQFQWLMKBJM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.65 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|