C12H20O3 — CID 11183452
(1'S,3'aR,7'aS)-7'a-methylspiro[1,3-dioxolane-2,5'-2,3,3a,4,6,7-hexahydro-1H-indene]-1'-ol (PubChem CID 11183452) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is (1'S,3'aR,7'aS)-7'a-methylspiro[1,3-dioxolane-2,5'-2,3,3a,4,6,7-hexahydro-1H-indene]-1'-ol.
| Compound Name | (1'S,3'aR,7'aS)-7'a-methylspiro[1,3-dioxolane-2,5'-2,3,3a,4,6,7-hexahydro-1H-indene]-1'-ol |
|---|---|
| PubChem CID | 11183452 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | (1'S,3'aR,7'aS)-7'a-methylspiro[1,3-dioxolane-2,5'-2,3,3a,4,6,7-hexahydro-1H-indene]-1'-ol |
| SMILES | C[C@]12CCC3(C[C@H]1CC[C@@H]2O)OCCO3 |
| InChI | InChI=1S/C12H20O3/c1-11-4-5-12(14-6-7-15-12)8-9(11)2-3-10(11)13/h9-10,13H,2-8H2,1H3/t9-,10+,11+/m1/s1 |
| InChIKey | XCNYSZSTINEICZ-VWYCJHECSA-N |
| XLogP | 1.69 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |