C13H25F3N4O — CID 111834977
1-ethyl-3-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-2-(oxolan-2-ylmethyl)guanidine (PubChem CID 111834977) has the molecular formula C13H25F3N4O and a molecular weight of 310.36 g/mol. Its IUPAC name is 1-ethyl-3-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-2-(oxolan-2-ylmethyl)guanidine.
| Compound Name | 1-ethyl-3-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-2-(oxolan-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111834977 |
| Molecular Formula | C13H25F3N4O |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | 1-ethyl-3-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-2-(oxolan-2-ylmethyl)guanidine |
| SMILES | CCN/C(=N\CC1CCCO1)NCCN(C)CC(F)(F)F |
| InChI | InChI=1S/C13H25F3N4O/c1-3-17-12(19-9-11-5-4-8-21-11)18-6-7-20(2)10-13(14,15)16/h11H,3-10H2,1-2H3,(H2,17,18,19) |
| InChIKey | YEEAIQMDVMEAHK-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|