About 2-[(5E)-7-methylocta-5,7-dienoxy]oxane
2-[(5E)-7-methylocta-5,7-dienoxy]oxane (PubChem CID 11183694) has the molecular formula C14H24O2
and a molecular weight of 224.34 g/mol. Its IUPAC name is 2-[(5E)-7-methylocta-5,7-dienoxy]oxane.
Molecular Properties
| Compound Name | 2-[(5E)-7-methylocta-5,7-dienoxy]oxane |
| PubChem CID | 11183694 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | 2-[(5E)-7-methylocta-5,7-dienoxy]oxane |
| SMILES | C=C(C)/C=C/CCCCOC1CCCCO1 |
| InChI | InChI=1S/C14H24O2/c1-13(2)9-5-3-4-7-11-15-14-10-6-8-12-16-14/h5,9,14H,1,3-4,6-8,10-12H2,2H3/b9-5+ |
| InChIKey | KMDFHCHBNSYQMA-WEVVVXLNSA-N |
| XLogP | 3.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(5E)-7-methylocta-5,7-dienoxy]oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5E)-7-methylocta-5,7-dienoxy]oxane?
The IUPAC name of 2-[(5E)-7-methylocta-5,7-dienoxy]oxane (CID 11183694) is 2-[(5E)-7-methylocta-5,7-dienoxy]oxane.
What is the SMILES notation for 2-[(5E)-7-methylocta-5,7-dienoxy]oxane?
The canonical SMILES for 2-[(5E)-7-methylocta-5,7-dienoxy]oxane is C=C(C)/C=C/CCCCOC1CCCCO1.
What is the InChIKey of 2-[(5E)-7-methylocta-5,7-dienoxy]oxane?
The InChIKey is KMDFHCHBNSYQMA-WEVVVXLNSA-N. The full InChI is InChI=1S/C14H24O2/c1-13(2)9-5-3-4-7-11-15-14-10-6-8-12-16-14/h5,9,14H,1,3-4,6-8,10-12H2,2H3/b9-5+.
What are the key properties of 2-[(5E)-7-methylocta-5,7-dienoxy]oxane?
2-[(5E)-7-methylocta-5,7-dienoxy]oxane has a molecular weight of 224.34 g/mol, XLogP of 3.83, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5E)-7-methylocta-5,7-dienoxy]oxane is sourced from PubChem (CID 11183694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).