C22H35N5OS — CID 111837716
1-[2-(4-tert-butyl-1,3-thiazol-2-yl)ethyl]-3-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-methylguanidine (PubChem CID 111837716) has the molecular formula C22H35N5OS and a molecular weight of 417.62 g/mol. Its IUPAC name is 1-[2-(4-tert-butyl-1,3-thiazol-2-yl)ethyl]-3-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-methylguanidine.
| Compound Name | 1-[2-(4-tert-butyl-1,3-thiazol-2-yl)ethyl]-3-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111837716 |
| Molecular Formula | C22H35N5OS |
| Molecular Weight | 417.62 g/mol |
| Exact Mass | 417.26 |
| IUPAC Name | 1-[2-(4-tert-butyl-1,3-thiazol-2-yl)ethyl]-3-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCc1nc(C(C)(C)C)cs1)NCC(c1ccco1)N1CCCCC1 |
| InChI | InChI=1S/C22H35N5OS/c1-22(2,3)19-16-29-20(26-19)10-11-24-21(23-4)25-15-17(18-9-8-14-28-18)27-12-6-5-7-13-27/h8-9,14,16-17H,5-7,10-13,15H2,1-4H3,(H2,23,24,25) |
| InChIKey | QOFQURGGQMVWCW-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 65.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.62 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|