C19H33F3IN5O — CID 111837733
1-ethyl-2-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-3-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]guanidine;hydroiodide (PubChem CID 111837733) has the molecular formula C19H33F3IN5O and a molecular weight of 531.41 g/mol. Its IUPAC name is 1-ethyl-2-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-3-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-3-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111837733 |
| Molecular Formula | C19H33F3IN5O |
| Molecular Weight | 531.41 g/mol |
| Exact Mass | 531.17 |
| IUPAC Name | 1-ethyl-2-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-3-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(c1ccco1)N1CCCCC1)NCCN(C)CC(F)(F)F.I |
| InChI | InChI=1S/C19H32F3N5O.HI/c1-3-23-18(24-9-12-26(2)15-19(20,21)22)25-14-16(17-8-7-13-28-17)27-10-5-4-6-11-27;/h7-8,13,16H,3-6,9-12,14-15H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | QOQYTOSWUMKIEB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 56.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|