C12H24O4 — CID 11183870
(2S,3R,4E)-1-methoxy-4-(2-methoxyethylidene)octane-2,3-diol (PubChem CID 11183870) has the molecular formula C12H24O4 and a molecular weight of 232.32 g/mol. Its IUPAC name is (2S,3R,4E)-1-methoxy-4-(2-methoxyethylidene)octane-2,3-diol.
| Compound Name | (2S,3R,4E)-1-methoxy-4-(2-methoxyethylidene)octane-2,3-diol |
|---|---|
| PubChem CID | 11183870 |
| Molecular Formula | C12H24O4 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | (2S,3R,4E)-1-methoxy-4-(2-methoxyethylidene)octane-2,3-diol |
| SMILES | CCCC/C(=C\COC)[C@@H](O)[C@@H](O)COC |
| InChI | InChI=1S/C12H24O4/c1-4-5-6-10(7-8-15-2)12(14)11(13)9-16-3/h7,11-14H,4-6,8-9H2,1-3H3/b10-7+/t11-,12+/m0/s1 |
| InChIKey | WXTLSZWWWWZOEC-GJKHTVIGSA-N |
| XLogP | 1.12 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|