C13H16O4 — CID 11183953
(1R,4S,7R,8R,11S)-spiro[3-oxatricyclo[5.3.1.04,11]undecane-8,2'-oxolane]-2,6-dione (PubChem CID 11183953) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is (1R,4S,7R,8R,11S)-spiro[3-oxatricyclo[5.3.1.04,11]undecane-8,2'-oxolane]-2,6-dione.
| Compound Name | (1R,4S,7R,8R,11S)-spiro[3-oxatricyclo[5.3.1.04,11]undecane-8,2'-oxolane]-2,6-dione |
|---|---|
| PubChem CID | 11183953 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | (1R,4S,7R,8R,11S)-spiro[3-oxatricyclo[5.3.1.04,11]undecane-8,2'-oxolane]-2,6-dione |
| SMILES | O=C1C[C@@H]2OC(=O)[C@@H]3CC[C@@]4(CCCO4)[C@H]1[C@H]23 |
| InChI | InChI=1S/C13H16O4/c14-8-6-9-10-7(12(15)17-9)2-4-13(11(8)10)3-1-5-16-13/h7,9-11H,1-6H2/t7-,9+,10+,11-,13+/m1/s1 |
| InChIKey | XIHXRGJIAMENHR-QHKDRZEJSA-N |
| XLogP | 1.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |