C19H35N5S — CID 111839623
1-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-[3-(4-methylpiperidin-1-yl)propyl]guanidine (PubChem CID 111839623) has the molecular formula C19H35N5S and a molecular weight of 365.59 g/mol. Its IUPAC name is 1-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-[3-(4-methylpiperidin-1-yl)propyl]guanidine.
| Compound Name | 1-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-[3-(4-methylpiperidin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111839623 |
| Molecular Formula | C19H35N5S |
| Molecular Weight | 365.59 g/mol |
| Exact Mass | 365.26 |
| IUPAC Name | 1-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-[3-(4-methylpiperidin-1-yl)propyl]guanidine |
| SMILES | C/N=C(/NCCCN1CCC(C)CC1)NCc1nc(C(C)(C)C)cs1 |
| InChI | InChI=1S/C19H35N5S/c1-15-7-11-24(12-8-15)10-6-9-21-18(20-5)22-13-17-23-16(14-25-17)19(2,3)4/h14-15H,6-13H2,1-5H3,(H2,20,21,22) |
| InChIKey | BZNLCMVQBBOSTH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.59 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|