About [(4R,6R)-6-hydroxyoct-7-en-4-yl] hex-5-enoate
[(4R,6R)-6-hydroxyoct-7-en-4-yl] hex-5-enoate (PubChem CID 11184060) has the molecular formula C14H24O3
and a molecular weight of 240.34 g/mol. Its IUPAC name is [(4R,6R)-6-hydroxyoct-7-en-4-yl] hex-5-enoate.
Molecular Properties
| Compound Name | [(4R,6R)-6-hydroxyoct-7-en-4-yl] hex-5-enoate |
| PubChem CID | 11184060 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | [(4R,6R)-6-hydroxyoct-7-en-4-yl] hex-5-enoate |
| SMILES | C=CCCCC(=O)O[C@H](CCC)C[C@@H](O)C=C |
| InChI | InChI=1S/C14H24O3/c1-4-7-8-10-14(16)17-13(9-5-2)11-12(15)6-3/h4,6,12-13,15H,1,3,5,7-11H2,2H3/t12-,13+/m0/s1 |
| InChIKey | UXEJVKSRWLUCOO-QWHCGFSZSA-N |
| XLogP | 2.99 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(4R,6R)-6-hydroxyoct-7-en-4-yl] hex-5-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4R,6R)-6-hydroxyoct-7-en-4-yl] hex-5-enoate?
The IUPAC name of [(4R,6R)-6-hydroxyoct-7-en-4-yl] hex-5-enoate (CID 11184060) is [(4R,6R)-6-hydroxyoct-7-en-4-yl] hex-5-enoate.
What is the SMILES notation for [(4R,6R)-6-hydroxyoct-7-en-4-yl] hex-5-enoate?
The canonical SMILES for [(4R,6R)-6-hydroxyoct-7-en-4-yl] hex-5-enoate is C=CCCCC(=O)O[C@H](CCC)C[C@@H](O)C=C.
What is the InChIKey of [(4R,6R)-6-hydroxyoct-7-en-4-yl] hex-5-enoate?
The InChIKey is UXEJVKSRWLUCOO-QWHCGFSZSA-N. The full InChI is InChI=1S/C14H24O3/c1-4-7-8-10-14(16)17-13(9-5-2)11-12(15)6-3/h4,6,12-13,15H,1,3,5,7-11H2,2H3/t12-,13+/m0/s1.
What are the key properties of [(4R,6R)-6-hydroxyoct-7-en-4-yl] hex-5-enoate?
[(4R,6R)-6-hydroxyoct-7-en-4-yl] hex-5-enoate has a molecular weight of 240.34 g/mol, XLogP of 2.99, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(4R,6R)-6-hydroxyoct-7-en-4-yl] hex-5-enoate is sourced from PubChem (CID 11184060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).