C13H15F3N2O3S — CID 111840773
3-(hydroxymethyl)-N-[4-(trifluoromethylsulfinyl)phenyl]pyrrolidine-1-carboxamide (PubChem CID 111840773) has the molecular formula C13H15F3N2O3S and a molecular weight of 336.34 g/mol. Its IUPAC name is 3-(hydroxymethyl)-N-[4-(trifluoromethylsulfinyl)phenyl]pyrrolidine-1-carboxamide.
| Compound Name | 3-(hydroxymethyl)-N-[4-(trifluoromethylsulfinyl)phenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 111840773 |
| Molecular Formula | C13H15F3N2O3S |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 3-(hydroxymethyl)-N-[4-(trifluoromethylsulfinyl)phenyl]pyrrolidine-1-carboxamide |
| SMILES | O=C(Nc1ccc(S(=O)C(F)(F)F)cc1)N1CCC(CO)C1 |
| InChI | InChI=1S/C13H15F3N2O3S/c14-13(15,16)22(21)11-3-1-10(2-4-11)17-12(20)18-6-5-9(7-18)8-19/h1-4,9,19H,5-8H2,(H,17,20) |
| InChIKey | POSOTESRXKHJSU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |