C16H23NO — CID 11184156
8,8-dimethyl-7-[methyl(prop-2-enyl)amino]-6,7-dihydro-5H-naphthalen-2-ol (PubChem CID 11184156) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is 8,8-dimethyl-7-[methyl(prop-2-enyl)amino]-6,7-dihydro-5H-naphthalen-2-ol.
| Compound Name | 8,8-dimethyl-7-[methyl(prop-2-enyl)amino]-6,7-dihydro-5H-naphthalen-2-ol |
|---|---|
| PubChem CID | 11184156 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | 8,8-dimethyl-7-[methyl(prop-2-enyl)amino]-6,7-dihydro-5H-naphthalen-2-ol |
| SMILES | C=CCN(C)C1CCc2ccc(O)cc2C1(C)C |
| InChI | InChI=1S/C16H23NO/c1-5-10-17(4)15-9-7-12-6-8-13(18)11-14(12)16(15,2)3/h5-6,8,11,15,18H,1,7,9-10H2,2-4H3 |
| InChIKey | RHQPASUQIGVBMR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|