C22H35FIN5O2 — CID 111841665
2-[[(cyclopentylamino)-[[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]amino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111841665) has the molecular formula C22H35FIN5O2 and a molecular weight of 547.46 g/mol. Its IUPAC name is 2-[[(cyclopentylamino)-[[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]amino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[(cyclopentylamino)-[[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]amino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111841665 |
| Molecular Formula | C22H35FIN5O2 |
| Molecular Weight | 547.46 g/mol |
| Exact Mass | 547.18 |
| IUPAC Name | 2-[[(cyclopentylamino)-[[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]amino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CN(C)C(=O)C/N=C(\NCC(c1ccc(F)cc1)N1CCOCC1)NC1CCCC1.I |
| InChI | InChI=1S/C22H34FN5O2.HI/c1-27(2)21(29)16-25-22(26-19-5-3-4-6-19)24-15-20(28-11-13-30-14-12-28)17-7-9-18(23)10-8-17;/h7-10,19-20H,3-6,11-16H2,1-2H3,(H2,24,25,26);1H |
| InChIKey | QDQKOWOPNINPFO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.46 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|