C9H11BrO3 — CID 11184198
(1S,2R,5S)-2-(bromomethyl)-2-methoxy-8-oxabicyclo[3.2.1]oct-6-en-3-one (PubChem CID 11184198) has the molecular formula C9H11BrO3 and a molecular weight of 247.09 g/mol. Its IUPAC name is (1S,2R,5S)-2-(bromomethyl)-2-methoxy-8-oxabicyclo[3.2.1]oct-6-en-3-one.
| Compound Name | (1S,2R,5S)-2-(bromomethyl)-2-methoxy-8-oxabicyclo[3.2.1]oct-6-en-3-one |
|---|---|
| PubChem CID | 11184198 |
| Molecular Formula | C9H11BrO3 |
| Molecular Weight | 247.09 g/mol |
| Exact Mass | 245.99 |
| IUPAC Name | (1S,2R,5S)-2-(bromomethyl)-2-methoxy-8-oxabicyclo[3.2.1]oct-6-en-3-one |
| SMILES | CO[C@@]1(CBr)C(=O)C[C@H]2C=C[C@@H]1O2 |
| InChI | InChI=1S/C9H11BrO3/c1-12-9(5-10)7(11)4-6-2-3-8(9)13-6/h2-3,6,8H,4-5H2,1H3/t6-,8+,9+/m1/s1 |
| InChIKey | IYYXNJGFCLFZAP-YEPSODPASA-N |
| XLogP | 1.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.09 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|