C15H21NO2 — CID 11184213
N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N,3-dimethylbut-2-enamide (PubChem CID 11184213) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N,3-dimethylbut-2-enamide.
| Compound Name | N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N,3-dimethylbut-2-enamide |
|---|---|
| PubChem CID | 11184213 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N,3-dimethylbut-2-enamide |
| SMILES | CC(C)=CC(=O)N(C)[C@@H](C)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C15H21NO2/c1-11(2)10-14(17)16(4)12(3)15(18)13-8-6-5-7-9-13/h5-10,12,15,18H,1-4H3/t12-,15+/m0/s1 |
| InChIKey | VCXPASUOIMTRKV-SWLSCSKDSA-N |
| XLogP | 2.53 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|