About N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N,3-dimethylbut-2-enamide
N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N,3-dimethylbut-2-enamide (PubChem CID 11184213) has the molecular formula C15H21NO2
and a molecular weight of 247.34 g/mol. Its IUPAC name is N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N,3-dimethylbut-2-enamide.
Molecular Properties
| Compound Name | N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N,3-dimethylbut-2-enamide |
| PubChem CID | 11184213 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N,3-dimethylbut-2-enamide |
| SMILES | CC(C)=CC(=O)N(C)[C@@H](C)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C15H21NO2/c1-11(2)10-14(17)16(4)12(3)15(18)13-8-6-5-7-9-13/h5-10,12,15,18H,1-4H3/t12-,15+/m0/s1 |
| InChIKey | VCXPASUOIMTRKV-SWLSCSKDSA-N |
| XLogP | 2.53 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N,3-dimethylbut-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N,3-dimethylbut-2-enamide?
The IUPAC name of N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N,3-dimethylbut-2-enamide (CID 11184213) is N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N,3-dimethylbut-2-enamide.
What is the SMILES notation for N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N,3-dimethylbut-2-enamide?
The canonical SMILES for N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N,3-dimethylbut-2-enamide is CC(C)=CC(=O)N(C)[C@@H](C)[C@@H](O)c1ccccc1.
What is the InChIKey of N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N,3-dimethylbut-2-enamide?
The InChIKey is VCXPASUOIMTRKV-SWLSCSKDSA-N. The full InChI is InChI=1S/C15H21NO2/c1-11(2)10-14(17)16(4)12(3)15(18)13-8-6-5-7-9-13/h5-10,12,15,18H,1-4H3/t12-,15+/m0/s1.
What are the key properties of N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N,3-dimethylbut-2-enamide?
N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N,3-dimethylbut-2-enamide has a molecular weight of 247.34 g/mol, XLogP of 2.53, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N,3-dimethylbut-2-enamide is sourced from PubChem (CID 11184213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).