C24H31IN6O2 — CID 111842557
2-[[N'-[(4-methoxyphenyl)methyl]-N-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111842557) has the molecular formula C24H31IN6O2 and a molecular weight of 562.46 g/mol. Its IUPAC name is 2-[[N'-[(4-methoxyphenyl)methyl]-N-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[N'-[(4-methoxyphenyl)methyl]-N-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111842557 |
| Molecular Formula | C24H31IN6O2 |
| Molecular Weight | 562.46 g/mol |
| Exact Mass | 562.16 |
| IUPAC Name | 2-[[N'-[(4-methoxyphenyl)methyl]-N-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | COc1ccc(C/N=C(\NCC(=O)N(C)C)NCc2ccccc2Cn2cccn2)cc1.I |
| InChI | InChI=1S/C24H30N6O2.HI/c1-29(2)23(31)17-27-24(25-15-19-9-11-22(32-3)12-10-19)26-16-20-7-4-5-8-21(20)18-30-14-6-13-28-30;/h4-14H,15-18H2,1-3H3,(H2,25,26,27);1H |
| InChIKey | XWXIOXTUFSNJPV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.46 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|