C12H18N4O2 — CID 11184271
(3aR,4R,10aS,10bS)-4-azido-2,2-dimethyl-4,5,7,10,10a,10b-hexahydro-3aH-[1,3]dioxolo[4,5-a]quinolizine (PubChem CID 11184271) has the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is (3aR,4R,10aS,10bS)-4-azido-2,2-dimethyl-4,5,7,10,10a,10b-hexahydro-3aH-[1,3]dioxolo[4,5-a]quinolizine.
| Compound Name | (3aR,4R,10aS,10bS)-4-azido-2,2-dimethyl-4,5,7,10,10a,10b-hexahydro-3aH-[1,3]dioxolo[4,5-a]quinolizine |
|---|---|
| PubChem CID | 11184271 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | (3aR,4R,10aS,10bS)-4-azido-2,2-dimethyl-4,5,7,10,10a,10b-hexahydro-3aH-[1,3]dioxolo[4,5-a]quinolizine |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@H](N=[N+]=[N-])CN1CC=CC[C@@H]21 |
| InChI | InChI=1S/C12H18N4O2/c1-12(2)17-10-8(14-15-13)7-16-6-4-3-5-9(16)11(10)18-12/h3-4,8-11H,5-7H2,1-2H3/t8-,9+,10-,11+/m1/s1 |
| InChIKey | MOORTPRKFOMWAB-YTWAJWBKSA-N |
| XLogP | 1.83 |
| TPSA | 70.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|