About [1]benzothiolo[3,2-b]chromen-11-one
[1]benzothiolo[3,2-b]chromen-11-one (PubChem CID 11184312) has the molecular formula C15H8O2S
and a molecular weight of 252.29 g/mol. Its IUPAC name is [1]benzothiolo[3,2-b]chromen-11-one.
Molecular Properties
| Compound Name | [1]benzothiolo[3,2-b]chromen-11-one |
| PubChem CID | 11184312 |
| Molecular Formula | C15H8O2S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | [1]benzothiolo[3,2-b]chromen-11-one |
| SMILES | O=c1c2ccccc2oc2c1sc1ccccc12 |
| InChI | InChI=1S/C15H8O2S/c16-13-9-5-1-3-7-11(9)17-14-10-6-2-4-8-12(10)18-15(13)14/h1-8H |
| InChIKey | NSSHVNKMKULSMJ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1]benzothiolo[3,2-b]chromen-11-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1]benzothiolo[3,2-b]chromen-11-one?
The IUPAC name of [1]benzothiolo[3,2-b]chromen-11-one (CID 11184312) is [1]benzothiolo[3,2-b]chromen-11-one.
What is the SMILES notation for [1]benzothiolo[3,2-b]chromen-11-one?
The canonical SMILES for [1]benzothiolo[3,2-b]chromen-11-one is O=c1c2ccccc2oc2c1sc1ccccc12.
What is the InChIKey of [1]benzothiolo[3,2-b]chromen-11-one?
The InChIKey is NSSHVNKMKULSMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H8O2S/c16-13-9-5-1-3-7-11(9)17-14-10-6-2-4-8-12(10)18-15(13)14/h1-8H.
What are the key properties of [1]benzothiolo[3,2-b]chromen-11-one?
[1]benzothiolo[3,2-b]chromen-11-one has a molecular weight of 252.29 g/mol, XLogP of 4.16, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1]benzothiolo[3,2-b]chromen-11-one is sourced from PubChem (CID 11184312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).