C19H20N4O3S — CID 111843696
2-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine (PubChem CID 111843696) has the molecular formula C19H20N4O3S and a molecular weight of 384.46 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111843696 |
| Molecular Formula | C19H20N4O3S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc2c(c1)OCO2)NCc1coc(-c2cccs2)n1 |
| InChI | InChI=1S/C19H20N4O3S/c1-2-20-19(21-9-13-5-6-15-16(8-13)26-12-25-15)22-10-14-11-24-18(23-14)17-4-3-7-27-17/h3-8,11H,2,9-10,12H2,1H3,(H2,20,21,22) |
| InChIKey | KNUGKTKUSWXRGG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|