C13H25NO4 — CID 11184515
tert-butyl N-[(E,3S,4R)-3,8-dihydroxyoct-5-en-4-yl]carbamate (PubChem CID 11184515) has the molecular formula C13H25NO4 and a molecular weight of 259.35 g/mol. Its IUPAC name is tert-butyl N-[(E,3S,4R)-3,8-dihydroxyoct-5-en-4-yl]carbamate.
| Compound Name | tert-butyl N-[(E,3S,4R)-3,8-dihydroxyoct-5-en-4-yl]carbamate |
|---|---|
| PubChem CID | 11184515 |
| Molecular Formula | C13H25NO4 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | tert-butyl N-[(E,3S,4R)-3,8-dihydroxyoct-5-en-4-yl]carbamate |
| SMILES | CC[C@H](O)[C@@H](/C=C/CCO)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H25NO4/c1-5-11(16)10(8-6-7-9-15)14-12(17)18-13(2,3)4/h6,8,10-11,15-16H,5,7,9H2,1-4H3,(H,14,17)/b8-6+/t10-,11+/m1/s1 |
| InChIKey | UPKKVRKWPMPGAP-QISKZBHPSA-N |
| XLogP | 1.59 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|