C24H32N4O4 — CID 111846149
1-(1,3-benzodioxol-5-ylmethyl)-3-ethyl-2-[[3-(2-morpholin-4-ylethoxy)phenyl]methyl]guanidine (PubChem CID 111846149) has the molecular formula C24H32N4O4 and a molecular weight of 440.54 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-ethyl-2-[[3-(2-morpholin-4-ylethoxy)phenyl]methyl]guanidine.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-ethyl-2-[[3-(2-morpholin-4-ylethoxy)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111846149 |
| Molecular Formula | C24H32N4O4 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-ethyl-2-[[3-(2-morpholin-4-ylethoxy)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(OCCN2CCOCC2)c1)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H32N4O4/c1-2-25-24(27-17-20-6-7-22-23(15-20)32-18-31-22)26-16-19-4-3-5-21(14-19)30-13-10-28-8-11-29-12-9-28/h3-7,14-15H,2,8-13,16-18H2,1H3,(H2,25,26,27) |
| InChIKey | JQEZZXBNSTVGDV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|