C15H20O4 — CID 11184636
(1S,3R,9R,10S,13R)-3-hydroxy-6,9,10-trimethyl-4,14-dioxatetracyclo[7.5.0.01,13.03,7]tetradec-6-en-5-one (PubChem CID 11184636) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is (1S,3R,9R,10S,13R)-3-hydroxy-6,9,10-trimethyl-4,14-dioxatetracyclo[7.5.0.01,13.03,7]tetradec-6-en-5-one.
| Compound Name | (1S,3R,9R,10S,13R)-3-hydroxy-6,9,10-trimethyl-4,14-dioxatetracyclo[7.5.0.01,13.03,7]tetradec-6-en-5-one |
|---|---|
| PubChem CID | 11184636 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | (1S,3R,9R,10S,13R)-3-hydroxy-6,9,10-trimethyl-4,14-dioxatetracyclo[7.5.0.01,13.03,7]tetradec-6-en-5-one |
| SMILES | CC1=C2C[C@]3(C)[C@@H](C)CC[C@H]4O[C@]43C[C@@]2(O)OC1=O |
| InChI | InChI=1S/C15H20O4/c1-8-4-5-11-14(18-11)7-15(17)10(6-13(8,14)3)9(2)12(16)19-15/h8,11,17H,4-7H2,1-3H3/t8-,11+,13+,14+,15+/m0/s1 |
| InChIKey | NSNPFQLBEDNILE-ZZVMUTNWSA-N |
| XLogP | 1.92 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|