C16H21N3 — CID 111848565
1-ethyl-2-[(1-phenylcyclopropyl)methyl]-3-prop-2-ynylguanidine (PubChem CID 111848565) has the molecular formula C16H21N3 and a molecular weight of 255.36 g/mol. Its IUPAC name is 1-ethyl-2-[(1-phenylcyclopropyl)methyl]-3-prop-2-ynylguanidine.
| Compound Name | 1-ethyl-2-[(1-phenylcyclopropyl)methyl]-3-prop-2-ynylguanidine |
|---|---|
| PubChem CID | 111848565 |
| Molecular Formula | C16H21N3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | 1-ethyl-2-[(1-phenylcyclopropyl)methyl]-3-prop-2-ynylguanidine |
| SMILES | C#CCN/C(=N/CC1(c2ccccc2)CC1)NCC |
| InChI | InChI=1S/C16H21N3/c1-3-12-18-15(17-4-2)19-13-16(10-11-16)14-8-6-5-7-9-14/h1,5-9H,4,10-13H2,2H3,(H2,17,18,19) |
| InChIKey | CDEMNAPCFQECAN-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|