C13H14F3NO2 — CID 11184877
ethyl (2S,3R)-1-benzyl-3-(trifluoromethyl)aziridine-2-carboxylate (PubChem CID 11184877) has the molecular formula C13H14F3NO2 and a molecular weight of 273.25 g/mol. Its IUPAC name is ethyl (2S,3R)-1-benzyl-3-(trifluoromethyl)aziridine-2-carboxylate.
| Compound Name | ethyl (2S,3R)-1-benzyl-3-(trifluoromethyl)aziridine-2-carboxylate |
|---|---|
| PubChem CID | 11184877 |
| Molecular Formula | C13H14F3NO2 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | ethyl (2S,3R)-1-benzyl-3-(trifluoromethyl)aziridine-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H](C(F)(F)F)N1Cc1ccccc1 |
| InChI | InChI=1S/C13H14F3NO2/c1-2-19-12(18)10-11(13(14,15)16)17(10)8-9-6-4-3-5-7-9/h3-7,10-11H,2,8H2,1H3/t10-,11+,17?/m0/s1 |
| InChIKey | LPLAIOZBDRHSOW-IYXXQPPLSA-N |
| XLogP | 2.36 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|