C15H15NO4 — CID 11184881
(6aR,10aS)-8,9-dimethyl-6a-nitro-10,10a-dihydro-7H-benzo[c]chromen-6-one (PubChem CID 11184881) has the molecular formula C15H15NO4 and a molecular weight of 273.29 g/mol. Its IUPAC name is (6aR,10aS)-8,9-dimethyl-6a-nitro-10,10a-dihydro-7H-benzo[c]chromen-6-one.
| Compound Name | (6aR,10aS)-8,9-dimethyl-6a-nitro-10,10a-dihydro-7H-benzo[c]chromen-6-one |
|---|---|
| PubChem CID | 11184881 |
| Molecular Formula | C15H15NO4 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | (6aR,10aS)-8,9-dimethyl-6a-nitro-10,10a-dihydro-7H-benzo[c]chromen-6-one |
| SMILES | CC1=C(C)C[C@]2([N+](=O)[O-])C(=O)Oc3ccccc3[C@@H]2C1 |
| InChI | InChI=1S/C15H15NO4/c1-9-7-12-11-5-3-4-6-13(11)20-14(17)15(12,16(18)19)8-10(9)2/h3-6,12H,7-8H2,1-2H3/t12-,15+/m0/s1 |
| InChIKey | KLDHVFUHDJBBHJ-SWLSCSKDSA-N |
| XLogP | 2.83 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|