About 2-bromo-3,3,3-trifluoro-1-piperidin-1-ylpropan-1-one
2-bromo-3,3,3-trifluoro-1-piperidin-1-ylpropan-1-one (PubChem CID 11184908) has the molecular formula C8H11BrF3NO
and a molecular weight of 274.08 g/mol. Its IUPAC name is 2-bromo-3,3,3-trifluoro-1-piperidin-1-ylpropan-1-one.
Molecular Properties
| Compound Name | 2-bromo-3,3,3-trifluoro-1-piperidin-1-ylpropan-1-one |
| PubChem CID | 11184908 |
| Molecular Formula | C8H11BrF3NO |
| Molecular Weight | 274.08 g/mol |
| Exact Mass | 273.00 |
| IUPAC Name | 2-bromo-3,3,3-trifluoro-1-piperidin-1-ylpropan-1-one |
| SMILES | O=C(C(Br)C(F)(F)F)N1CCCCC1 |
| InChI | InChI=1S/C8H11BrF3NO/c9-6(8(10,11)12)7(14)13-4-2-1-3-5-13/h6H,1-5H2 |
| InChIKey | BUOQTJVVDUWYRT-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.08 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-3,3,3-trifluoro-1-piperidin-1-ylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-3,3,3-trifluoro-1-piperidin-1-ylpropan-1-one?
The IUPAC name of 2-bromo-3,3,3-trifluoro-1-piperidin-1-ylpropan-1-one (CID 11184908) is 2-bromo-3,3,3-trifluoro-1-piperidin-1-ylpropan-1-one.
What is the SMILES notation for 2-bromo-3,3,3-trifluoro-1-piperidin-1-ylpropan-1-one?
The canonical SMILES for 2-bromo-3,3,3-trifluoro-1-piperidin-1-ylpropan-1-one is O=C(C(Br)C(F)(F)F)N1CCCCC1.
What is the InChIKey of 2-bromo-3,3,3-trifluoro-1-piperidin-1-ylpropan-1-one?
The InChIKey is BUOQTJVVDUWYRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11BrF3NO/c9-6(8(10,11)12)7(14)13-4-2-1-3-5-13/h6H,1-5H2.
What are the key properties of 2-bromo-3,3,3-trifluoro-1-piperidin-1-ylpropan-1-one?
2-bromo-3,3,3-trifluoro-1-piperidin-1-ylpropan-1-one has a molecular weight of 274.08 g/mol, XLogP of 2.32, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-3,3,3-trifluoro-1-piperidin-1-ylpropan-1-one is sourced from PubChem (CID 11184908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).