C15H17NO4 — CID 11184934
(2S,3aR,7S)-2-acetyl-7-methyl-3a-phenyl-2,3,6,7-tetrahydro-[1,2]oxazolo[3,2-c][1,4]oxazin-4-one (PubChem CID 11184934) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is (2S,3aR,7S)-2-acetyl-7-methyl-3a-phenyl-2,3,6,7-tetrahydro-[1,2]oxazolo[3,2-c][1,4]oxazin-4-one.
| Compound Name | (2S,3aR,7S)-2-acetyl-7-methyl-3a-phenyl-2,3,6,7-tetrahydro-[1,2]oxazolo[3,2-c][1,4]oxazin-4-one |
|---|---|
| PubChem CID | 11184934 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | (2S,3aR,7S)-2-acetyl-7-methyl-3a-phenyl-2,3,6,7-tetrahydro-[1,2]oxazolo[3,2-c][1,4]oxazin-4-one |
| SMILES | CC(=O)[C@@H]1C[C@@]2(c3ccccc3)C(=O)OC[C@H](C)N2O1 |
| InChI | InChI=1S/C15H17NO4/c1-10-9-19-14(18)15(12-6-4-3-5-7-12)8-13(11(2)17)20-16(10)15/h3-7,10,13H,8-9H2,1-2H3/t10-,13-,15+/m0/s1 |
| InChIKey | UZCBSYYAJMFWAQ-VZJVUDMVSA-N |
| XLogP | 1.42 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |