About Te-phenyl N,N-dimethylcarbamotelluroate
Te-phenyl N,N-dimethylcarbamotelluroate (PubChem CID 11184988) has the molecular formula C9H11NOTe
and a molecular weight of 276.79 g/mol. Its IUPAC name is Te-phenyl N,N-dimethylcarbamotelluroate.
Molecular Properties
| Compound Name | Te-phenyl N,N-dimethylcarbamotelluroate |
| PubChem CID | 11184988 |
| Molecular Formula | C9H11NOTe |
| Molecular Weight | 276.79 g/mol |
| Exact Mass | 278.99 |
| IUPAC Name | Te-phenyl N,N-dimethylcarbamotelluroate |
| SMILES | CN(C)C(=O)[Te]c1ccccc1 |
| InChI | InChI=1S/C9H11NOTe/c1-10(2)9(11)12-8-6-4-3-5-7-8/h3-7H,1-2H3 |
| InChIKey | OEUTWKROFSAWSE-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.79 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Te-phenyl N,N-dimethylcarbamotelluroate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Te-phenyl N,N-dimethylcarbamotelluroate?
The IUPAC name of Te-phenyl N,N-dimethylcarbamotelluroate (CID 11184988) is Te-phenyl N,N-dimethylcarbamotelluroate.
What is the SMILES notation for Te-phenyl N,N-dimethylcarbamotelluroate?
The canonical SMILES for Te-phenyl N,N-dimethylcarbamotelluroate is CN(C)C(=O)[Te]c1ccccc1.
What is the InChIKey of Te-phenyl N,N-dimethylcarbamotelluroate?
The InChIKey is OEUTWKROFSAWSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NOTe/c1-10(2)9(11)12-8-6-4-3-5-7-8/h3-7H,1-2H3.
What are the key properties of Te-phenyl N,N-dimethylcarbamotelluroate?
Te-phenyl N,N-dimethylcarbamotelluroate has a molecular weight of 276.79 g/mol, XLogP of 0.70, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Te-phenyl N,N-dimethylcarbamotelluroate is sourced from PubChem (CID 11184988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).