C25H35IN6O — CID 111850707
1-ethyl-3-[2-(5-methylfuran-2-yl)-2-pyrrolidin-1-ylethyl]-2-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111850707) has the molecular formula C25H35IN6O and a molecular weight of 562.50 g/mol. Its IUPAC name is 1-ethyl-3-[2-(5-methylfuran-2-yl)-2-pyrrolidin-1-ylethyl]-2-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(5-methylfuran-2-yl)-2-pyrrolidin-1-ylethyl]-2-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111850707 |
| Molecular Formula | C25H35IN6O |
| Molecular Weight | 562.50 g/mol |
| Exact Mass | 562.19 |
| IUPAC Name | 1-ethyl-3-[2-(5-methylfuran-2-yl)-2-pyrrolidin-1-ylethyl]-2-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1Cn1cccn1)NCC(c1ccc(C)o1)N1CCCC1.I |
| InChI | InChI=1S/C25H34N6O.HI/c1-3-26-25(27-17-21-9-4-5-10-22(21)19-31-16-8-13-29-31)28-18-23(30-14-6-7-15-30)24-12-11-20(2)32-24;/h4-5,8-13,16,23H,3,6-7,14-15,17-19H2,1-2H3,(H2,26,27,28);1H |
| InChIKey | AIEHVCXISXFQHI-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 70.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.50 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|