C7H7F7N4 — CID 11185092
5-(1,1,2,2,3,3,3-heptafluoropropyl)-N,1-dimethyl-1,2,4-triazol-3-amine (PubChem CID 11185092) has the molecular formula C7H7F7N4 and a molecular weight of 280.15 g/mol. Its IUPAC name is 5-(1,1,2,2,3,3,3-heptafluoropropyl)-N,1-dimethyl-1,2,4-triazol-3-amine.
| Compound Name | 5-(1,1,2,2,3,3,3-heptafluoropropyl)-N,1-dimethyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 11185092 |
| Molecular Formula | C7H7F7N4 |
| Molecular Weight | 280.15 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 5-(1,1,2,2,3,3,3-heptafluoropropyl)-N,1-dimethyl-1,2,4-triazol-3-amine |
| SMILES | CNc1nc(C(F)(F)C(F)(F)C(F)(F)F)n(C)n1 |
| InChI | InChI=1S/C7H7F7N4/c1-15-4-16-3(18(2)17-4)5(8,9)6(10,11)7(12,13)14/h1-2H3,(H,15,17) |
| InChIKey | COXLELXARHOAAF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.15 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|