C22H32IN7O — CID 111851647
1-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111851647) has the molecular formula C22H32IN7O and a molecular weight of 537.45 g/mol. Its IUPAC name is 1-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111851647 |
| Molecular Formula | C22H32IN7O |
| Molecular Weight | 537.45 g/mol |
| Exact Mass | 537.17 |
| IUPAC Name | 1-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccccc1Cn1cccn1)NCc1c(C)nn(CCOC)c1C.I |
| InChI | InChI=1S/C22H31N7O.HI/c1-17-21(18(2)29(27-17)12-13-30-4)15-25-22(23-3)24-14-19-8-5-6-9-20(19)16-28-11-7-10-26-28;/h5-11H,12-16H2,1-4H3,(H2,23,24,25);1H |
| InChIKey | UUTDHZFGZXIIGY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.45 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|