C24H30IN5 — CID 111852069
2-methyl-1-[[1-(2-methylphenyl)cyclopropyl]methyl]-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111852069) has the molecular formula C24H30IN5 and a molecular weight of 515.44 g/mol. Its IUPAC name is 2-methyl-1-[[1-(2-methylphenyl)cyclopropyl]methyl]-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[[1-(2-methylphenyl)cyclopropyl]methyl]-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111852069 |
| Molecular Formula | C24H30IN5 |
| Molecular Weight | 515.44 g/mol |
| Exact Mass | 515.15 |
| IUPAC Name | 2-methyl-1-[[1-(2-methylphenyl)cyclopropyl]methyl]-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccccc1Cn1cccn1)NCC1(c2ccccc2C)CC1.I |
| InChI | InChI=1S/C24H29N5.HI/c1-19-8-3-6-11-22(19)24(12-13-24)18-27-23(25-2)26-16-20-9-4-5-10-21(20)17-29-15-7-14-28-29;/h3-11,14-15H,12-13,16-18H2,1-2H3,(H2,25,26,27);1H |
| InChIKey | JDZYQAGPMNFVPJ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.44 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|