C22H30N6S — CID 111852198
1-[2-(dimethylamino)-2-thiophen-2-ylethyl]-3-ethyl-2-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine (PubChem CID 111852198) has the molecular formula C22H30N6S and a molecular weight of 410.59 g/mol. Its IUPAC name is 1-[2-(dimethylamino)-2-thiophen-2-ylethyl]-3-ethyl-2-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine.
| Compound Name | 1-[2-(dimethylamino)-2-thiophen-2-ylethyl]-3-ethyl-2-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111852198 |
| Molecular Formula | C22H30N6S |
| Molecular Weight | 410.59 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 1-[2-(dimethylamino)-2-thiophen-2-ylethyl]-3-ethyl-2-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccccc1Cn1cccn1)NCC(c1cccs1)N(C)C |
| InChI | InChI=1S/C22H30N6S/c1-4-23-22(25-16-20(27(2)3)21-11-7-14-29-21)24-15-18-9-5-6-10-19(18)17-28-13-8-12-26-28/h5-14,20H,4,15-17H2,1-3H3,(H2,23,24,25) |
| InChIKey | QRIIKOVKFOFAEX-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.59 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|