C20H32ClIN4O3 — CID 111852335
3-[[[2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethylamino]-(ethylamino)methylidene]amino]-N,N-diethylpropanamide;hydroiodide (PubChem CID 111852335) has the molecular formula C20H32ClIN4O3 and a molecular weight of 538.86 g/mol. Its IUPAC name is 3-[[[2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethylamino]-(ethylamino)methylidene]amino]-N,N-diethylpropanamide;hydroiodide.
| Compound Name | 3-[[[2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethylamino]-(ethylamino)methylidene]amino]-N,N-diethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111852335 |
| Molecular Formula | C20H32ClIN4O3 |
| Molecular Weight | 538.86 g/mol |
| Exact Mass | 538.12 |
| IUPAC Name | 3-[[[2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethylamino]-(ethylamino)methylidene]amino]-N,N-diethylpropanamide;hydroiodide |
| SMILES | CCN/C(=N\CCC(=O)N(CC)CC)NCCc1cc(Cl)c2c(c1)OCCO2.I |
| InChI | InChI=1S/C20H31ClN4O3.HI/c1-4-22-20(24-10-8-18(26)25(5-2)6-3)23-9-7-15-13-16(21)19-17(14-15)27-11-12-28-19;/h13-14H,4-12H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | YTMGUHYOEILUOT-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.86 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|