C14H23NO5 — CID 11185240
tert-butyl (1S,2S,4S,7R)-10,10-dimethyl-3,9,11-trioxa-6-azatricyclo[5.4.0.02,4]undecane-6-carboxylate (PubChem CID 11185240) has the molecular formula C14H23NO5 and a molecular weight of 285.34 g/mol. Its IUPAC name is tert-butyl (1S,2S,4S,7R)-10,10-dimethyl-3,9,11-trioxa-6-azatricyclo[5.4.0.02,4]undecane-6-carboxylate.
| Compound Name | tert-butyl (1S,2S,4S,7R)-10,10-dimethyl-3,9,11-trioxa-6-azatricyclo[5.4.0.02,4]undecane-6-carboxylate |
|---|---|
| PubChem CID | 11185240 |
| Molecular Formula | C14H23NO5 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | tert-butyl (1S,2S,4S,7R)-10,10-dimethyl-3,9,11-trioxa-6-azatricyclo[5.4.0.02,4]undecane-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2O[C@@H]2[C@H]2OC(C)(C)OC[C@H]21 |
| InChI | InChI=1S/C14H23NO5/c1-13(2,3)20-12(16)15-6-9-11(18-9)10-8(15)7-17-14(4,5)19-10/h8-11H,6-7H2,1-5H3/t8-,9+,10+,11+/m1/s1 |
| InChIKey | NGXXBVWFUFNSFP-RCWTZXSCSA-N |
| XLogP | 1.52 |
| TPSA | 60.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|