C23H36IN5 — CID 111852795
1-ethyl-2-[(1-phenylcyclopentyl)methyl]-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine;hydroiodide (PubChem CID 111852795) has the molecular formula C23H36IN5 and a molecular weight of 509.48 g/mol. Its IUPAC name is 1-ethyl-2-[(1-phenylcyclopentyl)methyl]-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(1-phenylcyclopentyl)methyl]-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111852795 |
| Molecular Formula | C23H36IN5 |
| Molecular Weight | 509.48 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | 1-ethyl-2-[(1-phenylcyclopentyl)methyl]-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1(c2ccccc2)CCCC1)NCCc1c(C)nn(C)c1C.I |
| InChI | InChI=1S/C23H35N5.HI/c1-5-24-22(25-16-13-21-18(2)27-28(4)19(21)3)26-17-23(14-9-10-15-23)20-11-7-6-8-12-20;/h6-8,11-12H,5,9-10,13-17H2,1-4H3,(H2,24,25,26);1H |
| InChIKey | RTOAZFCCCGJMGO-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.48 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|