C12H17NO7 — CID 11185297
[(3aS,4R,6R,6aS)-2,2-dimethyl-6-[(4R)-2-oxo-1,3-oxazolidin-4-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl] acetate (PubChem CID 11185297) has the molecular formula C12H17NO7 and a molecular weight of 287.27 g/mol. Its IUPAC name is [(3aS,4R,6R,6aS)-2,2-dimethyl-6-[(4R)-2-oxo-1,3-oxazolidin-4-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl] acetate.
| Compound Name | [(3aS,4R,6R,6aS)-2,2-dimethyl-6-[(4R)-2-oxo-1,3-oxazolidin-4-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl] acetate |
|---|---|
| PubChem CID | 11185297 |
| Molecular Formula | C12H17NO7 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | [(3aS,4R,6R,6aS)-2,2-dimethyl-6-[(4R)-2-oxo-1,3-oxazolidin-4-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1O[C@H]([C@H]2COC(=O)N2)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C12H17NO7/c1-5(14)17-10-9-8(19-12(2,3)20-9)7(18-10)6-4-16-11(15)13-6/h6-10H,4H2,1-3H3,(H,13,15)/t6-,7-,8+,9+,10+/m1/s1 |
| InChIKey | DRVCUXMLBMWLDF-ZJDVBMNYSA-N |
| XLogP | -0.10 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |