About (3S,6R)-3-[(E)-but-2-enyl]-6-methyl-4-[(1S)-1-phenylethyl]morpholine-2,5-dione
(3S,6R)-3-[(E)-but-2-enyl]-6-methyl-4-[(1S)-1-phenylethyl]morpholine-2,5-dione (PubChem CID 11185308) has the molecular formula C17H21NO3
and a molecular weight of 287.36 g/mol. Its IUPAC name is (3S,6R)-3-[(E)-but-2-enyl]-6-methyl-4-[(1S)-1-phenylethyl]morpholine-2,5-dione.
Molecular Properties
| Compound Name | (3S,6R)-3-[(E)-but-2-enyl]-6-methyl-4-[(1S)-1-phenylethyl]morpholine-2,5-dione |
| PubChem CID | 11185308 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | (3S,6R)-3-[(E)-but-2-enyl]-6-methyl-4-[(1S)-1-phenylethyl]morpholine-2,5-dione |
| SMILES | C/C=C/C[C@H]1C(=O)O[C@H](C)C(=O)N1[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C17H21NO3/c1-4-5-11-15-17(20)21-13(3)16(19)18(15)12(2)14-9-7-6-8-10-14/h4-10,12-13,15H,11H2,1-3H3/b5-4+/t12-,13+,15-/m0/s1 |
| InChIKey | GILLUZFEHGAJOJ-UVDPRHOXSA-N |
| XLogP | 2.86 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3S,6R)-3-[(E)-but-2-enyl]-6-methyl-4-[(1S)-1-phenylethyl]morpholine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,6R)-3-[(E)-but-2-enyl]-6-methyl-4-[(1S)-1-phenylethyl]morpholine-2,5-dione?
The IUPAC name of (3S,6R)-3-[(E)-but-2-enyl]-6-methyl-4-[(1S)-1-phenylethyl]morpholine-2,5-dione (CID 11185308) is (3S,6R)-3-[(E)-but-2-enyl]-6-methyl-4-[(1S)-1-phenylethyl]morpholine-2,5-dione.
What is the SMILES notation for (3S,6R)-3-[(E)-but-2-enyl]-6-methyl-4-[(1S)-1-phenylethyl]morpholine-2,5-dione?
The canonical SMILES for (3S,6R)-3-[(E)-but-2-enyl]-6-methyl-4-[(1S)-1-phenylethyl]morpholine-2,5-dione is C/C=C/C[C@H]1C(=O)O[C@H](C)C(=O)N1[C@@H](C)c1ccccc1.
What is the InChIKey of (3S,6R)-3-[(E)-but-2-enyl]-6-methyl-4-[(1S)-1-phenylethyl]morpholine-2,5-dione?
The InChIKey is GILLUZFEHGAJOJ-UVDPRHOXSA-N. The full InChI is InChI=1S/C17H21NO3/c1-4-5-11-15-17(20)21-13(3)16(19)18(15)12(2)14-9-7-6-8-10-14/h4-10,12-13,15H,11H2,1-3H3/b5-4+/t12-,13+,15-/m0/s1.
What are the key properties of (3S,6R)-3-[(E)-but-2-enyl]-6-methyl-4-[(1S)-1-phenylethyl]morpholine-2,5-dione?
(3S,6R)-3-[(E)-but-2-enyl]-6-methyl-4-[(1S)-1-phenylethyl]morpholine-2,5-dione has a molecular weight of 287.36 g/mol, XLogP of 2.86, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,6R)-3-[(E)-but-2-enyl]-6-methyl-4-[(1S)-1-phenylethyl]morpholine-2,5-dione is sourced from PubChem (CID 11185308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).