C18H25NO2 — CID 11185312
(3S,4S,5R)-2-benzyl-3-cyclohexyl-5-methyl-1,2-oxazolidine-4-carbaldehyde (PubChem CID 11185312) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is (3S,4S,5R)-2-benzyl-3-cyclohexyl-5-methyl-1,2-oxazolidine-4-carbaldehyde.
| Compound Name | (3S,4S,5R)-2-benzyl-3-cyclohexyl-5-methyl-1,2-oxazolidine-4-carbaldehyde |
|---|---|
| PubChem CID | 11185312 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | (3S,4S,5R)-2-benzyl-3-cyclohexyl-5-methyl-1,2-oxazolidine-4-carbaldehyde |
| SMILES | C[C@H]1ON(Cc2ccccc2)[C@@H](C2CCCCC2)[C@@H]1C=O |
| InChI | InChI=1S/C18H25NO2/c1-14-17(13-20)18(16-10-6-3-7-11-16)19(21-14)12-15-8-4-2-5-9-15/h2,4-5,8-9,13-14,16-18H,3,6-7,10-12H2,1H3/t14-,17-,18+/m1/s1 |
| InChIKey | FMIUXPDJSQVWCI-OLMNPRSZSA-N |
| XLogP | 3.59 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|