About 5-(2,6-difluorophenyl)-3-methyl-2H-pyrazolo[4,3-c]isoquinoline
5-(2,6-difluorophenyl)-3-methyl-2H-pyrazolo[4,3-c]isoquinoline (PubChem CID 11185520) has the molecular formula C17H11F2N3
and a molecular weight of 295.29 g/mol. Its IUPAC name is 5-(2,6-difluorophenyl)-3-methyl-2H-pyrazolo[4,3-c]isoquinoline.
Molecular Properties
| Compound Name | 5-(2,6-difluorophenyl)-3-methyl-2H-pyrazolo[4,3-c]isoquinoline |
| PubChem CID | 11185520 |
| Molecular Formula | C17H11F2N3 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 5-(2,6-difluorophenyl)-3-methyl-2H-pyrazolo[4,3-c]isoquinoline |
| SMILES | Cc1[nH]nc2c1nc(-c1c(F)cccc1F)c1ccccc12 |
| InChI | InChI=1S/C17H11F2N3/c1-9-15-17(22-21-9)11-6-3-2-5-10(11)16(20-15)14-12(18)7-4-8-13(14)19/h2-8H,1H3,(H,21,22) |
| InChIKey | WCRWFERTXDPGSF-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(2,6-difluorophenyl)-3-methyl-2H-pyrazolo[4,3-c]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,6-difluorophenyl)-3-methyl-2H-pyrazolo[4,3-c]isoquinoline?
The IUPAC name of 5-(2,6-difluorophenyl)-3-methyl-2H-pyrazolo[4,3-c]isoquinoline (CID 11185520) is 5-(2,6-difluorophenyl)-3-methyl-2H-pyrazolo[4,3-c]isoquinoline.
What is the SMILES notation for 5-(2,6-difluorophenyl)-3-methyl-2H-pyrazolo[4,3-c]isoquinoline?
The canonical SMILES for 5-(2,6-difluorophenyl)-3-methyl-2H-pyrazolo[4,3-c]isoquinoline is Cc1[nH]nc2c1nc(-c1c(F)cccc1F)c1ccccc12.
What is the InChIKey of 5-(2,6-difluorophenyl)-3-methyl-2H-pyrazolo[4,3-c]isoquinoline?
The InChIKey is WCRWFERTXDPGSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11F2N3/c1-9-15-17(22-21-9)11-6-3-2-5-10(11)16(20-15)14-12(18)7-4-8-13(14)19/h2-8H,1H3,(H,21,22).
What are the key properties of 5-(2,6-difluorophenyl)-3-methyl-2H-pyrazolo[4,3-c]isoquinoline?
5-(2,6-difluorophenyl)-3-methyl-2H-pyrazolo[4,3-c]isoquinoline has a molecular weight of 295.29 g/mol, XLogP of 4.36, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,6-difluorophenyl)-3-methyl-2H-pyrazolo[4,3-c]isoquinoline is sourced from PubChem (CID 11185520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).