C22H27F3N4O2 — CID 111856536
1-[[6-(cyclopropylmethoxy)-3-pyridinyl]methyl]-2-methyl-3-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine (PubChem CID 111856536) has the molecular formula C22H27F3N4O2 and a molecular weight of 436.48 g/mol. Its IUPAC name is 1-[[6-(cyclopropylmethoxy)-3-pyridinyl]methyl]-2-methyl-3-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine.
| Compound Name | 1-[[6-(cyclopropylmethoxy)-3-pyridinyl]methyl]-2-methyl-3-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111856536 |
| Molecular Formula | C22H27F3N4O2 |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | 1-[[6-(cyclopropylmethoxy)-3-pyridinyl]methyl]-2-methyl-3-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine |
| SMILES | C/N=C(\NCc1ccc(COCC(F)(F)F)cc1)NCc1ccc(OCC2CC2)nc1 |
| InChI | InChI=1S/C22H27F3N4O2/c1-26-21(29-12-19-8-9-20(27-11-19)31-14-18-6-7-18)28-10-16-2-4-17(5-3-16)13-30-15-22(23,24)25/h2-5,8-9,11,18H,6-7,10,12-15H2,1H3,(H2,26,28,29) |
| InChIKey | MQLJDNQPFAFKLP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|