C17H25N3S — CID 111858286
1-cyclopropyl-2-[[1-(4-methylphenyl)sulfanylcyclopentyl]methyl]guanidine (PubChem CID 111858286) has the molecular formula C17H25N3S and a molecular weight of 303.48 g/mol. Its IUPAC name is 1-cyclopropyl-2-[[1-(4-methylphenyl)sulfanylcyclopentyl]methyl]guanidine.
| Compound Name | 1-cyclopropyl-2-[[1-(4-methylphenyl)sulfanylcyclopentyl]methyl]guanidine |
|---|---|
| PubChem CID | 111858286 |
| Molecular Formula | C17H25N3S |
| Molecular Weight | 303.48 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 1-cyclopropyl-2-[[1-(4-methylphenyl)sulfanylcyclopentyl]methyl]guanidine |
| SMILES | Cc1ccc(SC2(C/N=C(\N)NC3CC3)CCCC2)cc1 |
| InChI | InChI=1S/C17H25N3S/c1-13-4-8-15(9-5-13)21-17(10-2-3-11-17)12-19-16(18)20-14-6-7-14/h4-5,8-9,14H,2-3,6-7,10-12H2,1H3,(H3,18,19,20) |
| InChIKey | WYNFUJGCAIPZFS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.48 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|