C17H30N2OSi — CID 11185854
(4S,9aR)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,6,7,8,9,9a-hexahydro-3H-quinolizine-4-carbonitrile (PubChem CID 11185854) has the molecular formula C17H30N2OSi and a molecular weight of 306.53 g/mol. Its IUPAC name is (4S,9aR)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,6,7,8,9,9a-hexahydro-3H-quinolizine-4-carbonitrile.
| Compound Name | (4S,9aR)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,6,7,8,9,9a-hexahydro-3H-quinolizine-4-carbonitrile |
|---|---|
| PubChem CID | 11185854 |
| Molecular Formula | C17H30N2OSi |
| Molecular Weight | 306.53 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | (4S,9aR)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,6,7,8,9,9a-hexahydro-3H-quinolizine-4-carbonitrile |
| SMILES | CC(C)(C)[Si](C)(C)OCC1=C[C@H]2CCCCN2[C@H](C#N)C1 |
| InChI | InChI=1S/C17H30N2OSi/c1-17(2,3)21(4,5)20-13-14-10-15-8-6-7-9-19(15)16(11-14)12-18/h10,15-16H,6-9,11,13H2,1-5H3/t15-,16+/m1/s1 |
| InChIKey | MRQNQZRPMIJYKT-CVEARBPZSA-N |
| XLogP | 4.08 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.53 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|