C17H15F3O2 — CID 11185909
2-propyl-5-[(E)-2-(2,4,6-trifluorophenyl)ethenyl]benzene-1,3-diol (PubChem CID 11185909) has the molecular formula C17H15F3O2 and a molecular weight of 308.30 g/mol. Its IUPAC name is 2-propyl-5-[(E)-2-(2,4,6-trifluorophenyl)ethenyl]benzene-1,3-diol.
| Compound Name | 2-propyl-5-[(E)-2-(2,4,6-trifluorophenyl)ethenyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 11185909 |
| Molecular Formula | C17H15F3O2 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 2-propyl-5-[(E)-2-(2,4,6-trifluorophenyl)ethenyl]benzene-1,3-diol |
| SMILES | CCCc1c(O)cc(/C=C/c2c(F)cc(F)cc2F)cc1O |
| InChI | InChI=1S/C17H15F3O2/c1-2-3-13-16(21)6-10(7-17(13)22)4-5-12-14(19)8-11(18)9-15(12)20/h4-9,21-22H,2-3H2,1H3/b5-4+ |
| InChIKey | FZPNZGZXJHKVPQ-SNAWJCMRSA-N |
| XLogP | 4.64 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|