C13H24O8 — CID 11185911
(3R,4S,5R,6S)-6-ethenyl-3,4,5-tris(methoxymethoxy)oxan-2-ol (PubChem CID 11185911) has the molecular formula C13H24O8 and a molecular weight of 308.33 g/mol. Its IUPAC name is (3R,4S,5R,6S)-6-ethenyl-3,4,5-tris(methoxymethoxy)oxan-2-ol.
| Compound Name | (3R,4S,5R,6S)-6-ethenyl-3,4,5-tris(methoxymethoxy)oxan-2-ol |
|---|---|
| PubChem CID | 11185911 |
| Molecular Formula | C13H24O8 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | (3R,4S,5R,6S)-6-ethenyl-3,4,5-tris(methoxymethoxy)oxan-2-ol |
| SMILES | C=C[C@@H]1OC(O)[C@H](OCOC)[C@@H](OCOC)[C@@H]1OCOC |
| InChI | InChI=1S/C13H24O8/c1-5-9-10(18-6-15-2)11(19-7-16-3)12(13(14)21-9)20-8-17-4/h5,9-14H,1,6-8H2,2-4H3/t9-,10+,11-,12+,13?/m0/s1 |
| InChIKey | BBAWTAJUEDLFSR-KZKMVBDOSA-N |
| XLogP | -0.14 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|