C16H34IN5O — CID 111859814
2-[4-[[[amino(propylamino)methylidene]amino]methyl]piperidin-1-yl]-N-tert-butylacetamide;hydroiodide (PubChem CID 111859814) has the molecular formula C16H34IN5O and a molecular weight of 439.39 g/mol. Its IUPAC name is 2-[4-[[[amino(propylamino)methylidene]amino]methyl]piperidin-1-yl]-N-tert-butylacetamide;hydroiodide.
| Compound Name | 2-[4-[[[amino(propylamino)methylidene]amino]methyl]piperidin-1-yl]-N-tert-butylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111859814 |
| Molecular Formula | C16H34IN5O |
| Molecular Weight | 439.39 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 2-[4-[[[amino(propylamino)methylidene]amino]methyl]piperidin-1-yl]-N-tert-butylacetamide;hydroiodide |
| SMILES | CCCN/C(N)=N/CC1CCN(CC(=O)NC(C)(C)C)CC1.I |
| InChI | InChI=1S/C16H33N5O.HI/c1-5-8-18-15(17)19-11-13-6-9-21(10-7-13)12-14(22)20-16(2,3)4;/h13H,5-12H2,1-4H3,(H,20,22)(H3,17,18,19);1H |
| InChIKey | SMGTXJLYDSYRTN-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.39 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|