C18H21ClIN3O2 — CID 111860591
1-[(3-chlorophenyl)methyl]-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methylguanidine;hydroiodide (PubChem CID 111860591) has the molecular formula C18H21ClIN3O2 and a molecular weight of 473.74 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(3-chlorophenyl)methyl]-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111860591 |
| Molecular Formula | C18H21ClIN3O2 |
| Molecular Weight | 473.74 g/mol |
| Exact Mass | 473.04 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1cccc(Cl)c1)Nc1ccc2c(c1)OCCCO2.I |
| InChI | InChI=1S/C18H20ClN3O2.HI/c1-20-18(21-12-13-4-2-5-14(19)10-13)22-15-6-7-16-17(11-15)24-9-3-8-23-16;/h2,4-7,10-11H,3,8-9,12H2,1H3,(H2,20,21,22);1H |
| InChIKey | FOGNNUPMUCFTQW-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.74 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|