C15H21FN2O2 — CID 111861119
1-(5-fluoro-2-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)-3-(3-hydroxypropyl)urea (PubChem CID 111861119) has the molecular formula C15H21FN2O2 and a molecular weight of 280.34 g/mol. Its IUPAC name is 1-(5-fluoro-2-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)-3-(3-hydroxypropyl)urea.
| Compound Name | 1-(5-fluoro-2-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)-3-(3-hydroxypropyl)urea |
|---|---|
| PubChem CID | 111861119 |
| Molecular Formula | C15H21FN2O2 |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 1-(5-fluoro-2-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)-3-(3-hydroxypropyl)urea |
| SMILES | CC1CCc2c(F)cccc2C1NC(=O)NCCCO |
| InChI | InChI=1S/C15H21FN2O2/c1-10-6-7-11-12(4-2-5-13(11)16)14(10)18-15(20)17-8-3-9-19/h2,4-5,10,14,19H,3,6-9H2,1H3,(H2,17,18,20) |
| InChIKey | AQSDXANMXPDINW-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|