C16H29N5O2 — CID 111861132
1-(2-hydroxy-2-propylpentyl)-3-(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-8-yl)urea (PubChem CID 111861132) has the molecular formula C16H29N5O2 and a molecular weight of 323.44 g/mol. Its IUPAC name is 1-(2-hydroxy-2-propylpentyl)-3-(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-8-yl)urea.
| Compound Name | 1-(2-hydroxy-2-propylpentyl)-3-(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-8-yl)urea |
|---|---|
| PubChem CID | 111861132 |
| Molecular Formula | C16H29N5O2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.23 |
| IUPAC Name | 1-(2-hydroxy-2-propylpentyl)-3-(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-8-yl)urea |
| SMILES | CCCC(O)(CCC)CNC(=O)NC1CCCn2c(C)nnc21 |
| InChI | InChI=1S/C16H29N5O2/c1-4-8-16(23,9-5-2)11-17-15(22)18-13-7-6-10-21-12(3)19-20-14(13)21/h13,23H,4-11H2,1-3H3,(H2,17,18,22) |
| InChIKey | KPTCGALHJHZGDI-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |