C20H29IN4O2S — CID 111861381
N,N-dimethyl-2-[[[2-(4-methylphenoxy)ethylamino]-(2-thiophen-2-ylethylamino)methylidene]amino]acetamide;hydroiodide (PubChem CID 111861381) has the molecular formula C20H29IN4O2S and a molecular weight of 516.45 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[2-(4-methylphenoxy)ethylamino]-(2-thiophen-2-ylethylamino)methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[[2-(4-methylphenoxy)ethylamino]-(2-thiophen-2-ylethylamino)methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111861381 |
| Molecular Formula | C20H29IN4O2S |
| Molecular Weight | 516.45 g/mol |
| Exact Mass | 516.11 |
| IUPAC Name | N,N-dimethyl-2-[[[2-(4-methylphenoxy)ethylamino]-(2-thiophen-2-ylethylamino)methylidene]amino]acetamide;hydroiodide |
| SMILES | Cc1ccc(OCCN/C(=N/CC(=O)N(C)C)NCCc2cccs2)cc1.I |
| InChI | InChI=1S/C20H28N4O2S.HI/c1-16-6-8-17(9-7-16)26-13-12-22-20(23-15-19(25)24(2)3)21-11-10-18-5-4-14-27-18;/h4-9,14H,10-13,15H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | SIXDIEMPJNPRTK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|